C11H18ClN5O3 — CID 119454304
2-methyl-2-(4-nitropyrazol-1-yl)-N-pyrrolidin-3-ylpropanamide;hydrochloride (PubChem CID 119454304) has the molecular formula C11H18ClN5O3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-methyl-2-(4-nitropyrazol-1-yl)-N-pyrrolidin-3-ylpropanamide;hydrochloride.
| Compound Name | 2-methyl-2-(4-nitropyrazol-1-yl)-N-pyrrolidin-3-ylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119454304 |
| Molecular Formula | C11H18ClN5O3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-methyl-2-(4-nitropyrazol-1-yl)-N-pyrrolidin-3-ylpropanamide;hydrochloride |
| SMILES | CC(C)(C(=O)NC1CCNC1)n1cc([N+](=O)[O-])cn1.Cl |
| InChI | InChI=1S/C11H17N5O3.ClH/c1-11(2,10(17)14-8-3-4-12-5-8)15-7-9(6-13-15)16(18)19;/h6-8,12H,3-5H2,1-2H3,(H,14,17);1H |
| InChIKey | FLHVXUXLSQCZNP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|