C9H12N4O3 — CID 79689166
4-nitro-N-[(3R)-pyrrolidin-3-yl]-1H-pyrrole-2-carboxamide (PubChem CID 79689166) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-nitro-N-[(3R)-pyrrolidin-3-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-nitro-N-[(3R)-pyrrolidin-3-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79689166 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-nitro-N-[(3R)-pyrrolidin-3-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCNC1)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C9H12N4O3/c14-9(12-6-1-2-10-4-6)8-3-7(5-11-8)13(15)16/h3,5-6,10-11H,1-2,4H2,(H,12,14)/t6-/m1/s1 |
| InChIKey | FKYNVJWPHHCUMW-ZCFIWIBFSA-N |
| XLogP | 0.01 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|