C10H14N4O3 — CID 63251739
N-(2-aminocyclopentyl)-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 63251739) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-aminocyclopentyl)-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63251739 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-(2-aminocyclopentyl)-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | NC1CCCC1NC(=O)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C10H14N4O3/c11-7-2-1-3-8(7)13-10(15)9-4-6(5-12-9)14(16)17/h4-5,7-8,12H,1-3,11H2,(H,13,15) |
| InChIKey | MONUDZQNGUZMJI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|