C14H11F2N3O3 — CID 127264724
N-[2-(2,4-difluorophenyl)cyclopropyl]-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 127264724) has the molecular formula C14H11F2N3O3 and a molecular weight of 307.26 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)cyclopropyl]-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[2-(2,4-difluorophenyl)cyclopropyl]-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 127264724 |
| Molecular Formula | C14H11F2N3O3 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)cyclopropyl]-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC1CC1c1ccc(F)cc1F)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C14H11F2N3O3/c15-7-1-2-9(11(16)3-7)10-5-12(10)18-14(20)13-4-8(6-17-13)19(21)22/h1-4,6,10,12,17H,5H2,(H,18,20) |
| InChIKey | JTBMFBQVBCKKOS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|