C19H14FN3O3S — CID 97011678
N-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 97011678) has the molecular formula C19H14FN3O3S and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 97011678 |
| Molecular Formula | C19H14FN3O3S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]1c1cccc(F)c1)c1csc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H14FN3O3S/c20-13-5-1-3-11(7-13)15-9-16(15)21-18(24)17-10-27-19(22-17)12-4-2-6-14(8-12)23(25)26/h1-8,10,15-16H,9H2,(H,21,24)/t15-,16+/m0/s1 |
| InChIKey | MVWKSTXMRFNNPB-JKSUJKDBSA-N |
| XLogP | 4.14 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|