C14H15N3O4S — CID 111433598
N-(3-hydroxybutyl)-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 111433598) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-hydroxybutyl)-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 111433598 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-(3-hydroxybutyl)-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(O)CCNC(=O)c1csc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H15N3O4S/c1-9(18)5-6-15-13(19)12-8-22-14(16-12)10-3-2-4-11(7-10)17(20)21/h2-4,7-9,18H,5-6H2,1H3,(H,15,19) |
| InChIKey | WNHWYODAABKMJP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|