C15H15N3O5S — CID 119369388
(2R)-3-methyl-2-[[2-(3-nitrophenyl)-1,3-thiazole-4-carbonyl]amino]butanoic acid (PubChem CID 119369388) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[2-(3-nitrophenyl)-1,3-thiazole-4-carbonyl]amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[2-(3-nitrophenyl)-1,3-thiazole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119369388 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (2R)-3-methyl-2-[[2-(3-nitrophenyl)-1,3-thiazole-4-carbonyl]amino]butanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1csc(-c2cccc([N+](=O)[O-])c2)n1)C(=O)O |
| InChI | InChI=1S/C15H15N3O5S/c1-8(2)12(15(20)21)17-13(19)11-7-24-14(16-11)9-4-3-5-10(6-9)18(22)23/h3-8,12H,1-2H3,(H,17,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | DKBQJMKMTCWDPV-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|