C19H14FN3O3S2 — CID 95068183
N-[(4R)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 95068183) has the molecular formula C19H14FN3O3S2 and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[(4R)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(4R)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 95068183 |
| Molecular Formula | C19H14FN3O3S2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[(4R)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-2-(3-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCSc2c(F)cccc21)c1csc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H14FN3O3S2/c20-14-6-2-5-13-15(7-8-27-17(13)14)21-18(24)16-10-28-19(22-16)11-3-1-4-12(9-11)23(25)26/h1-6,9-10,15H,7-8H2,(H,21,24)/t15-/m1/s1 |
| InChIKey | LPTFBMJCYZRRCX-OAHLLOKOSA-N |
| XLogP | 4.82 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|