C17H16FN3O3S — CID 86986422
1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-(2-methyl-5-nitrophenyl)urea (PubChem CID 86986422) has the molecular formula C17H16FN3O3S and a molecular weight of 361.40 g/mol. Its IUPAC name is 1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-(2-methyl-5-nitrophenyl)urea.
| Compound Name | 1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-(2-methyl-5-nitrophenyl)urea |
|---|---|
| PubChem CID | 86986422 |
| Molecular Formula | C17H16FN3O3S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-(2-methyl-5-nitrophenyl)urea |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)NC1CCSc2c(F)cccc21 |
| InChI | InChI=1S/C17H16FN3O3S/c1-10-5-6-11(21(23)24)9-15(10)20-17(22)19-14-7-8-25-16-12(14)3-2-4-13(16)18/h2-6,9,14H,7-8H2,1H3,(H2,19,20,22) |
| InChIKey | XYPYKLFTIBZXIT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|