C16H21F4N3OS — CID 87007370
1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea (PubChem CID 87007370) has the molecular formula C16H21F4N3OS and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea.
| Compound Name | 1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
|---|---|
| PubChem CID | 87007370 |
| Molecular Formula | C16H21F4N3OS |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
| SMILES | CN(CCCNC(=O)NC1CCSc2c(F)cccc21)CC(F)(F)F |
| InChI | InChI=1S/C16H21F4N3OS/c1-23(10-16(18,19)20)8-3-7-21-15(24)22-13-6-9-25-14-11(13)4-2-5-12(14)17/h2,4-5,13H,3,6-10H2,1H3,(H2,21,22,24) |
| InChIKey | BABVSILUIMXIAI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|