C16H19FN2O2S — CID 129371063
1-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 129371063) has the molecular formula C16H19FN2O2S and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 129371063 |
| Molecular Formula | C16H19FN2O2S |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)N[C@H]1CCSc2c(F)cccc21 |
| InChI | InChI=1S/C16H19FN2O2S/c17-13-3-1-2-12-14(6-7-22-15(12)13)19-16(21)18-11-5-4-10(8-11)9-20/h1-5,10-11,14,20H,6-9H2,(H2,18,19,21)/t10-,11+,14-/m0/s1 |
| InChIKey | QZBKOQQGWLVMCL-WDMOLILDSA-N |
| XLogP | 2.60 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|