C16H16FN3O3S2 — CID 27870361
1-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-(4-sulfamoylphenyl)urea (PubChem CID 27870361) has the molecular formula C16H16FN3O3S2 and a molecular weight of 381.45 g/mol. Its IUPAC name is 1-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 27870361 |
| Molecular Formula | C16H16FN3O3S2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)N[C@H]2CCSc3c(F)cccc32)cc1 |
| InChI | InChI=1S/C16H16FN3O3S2/c17-13-3-1-2-12-14(8-9-24-15(12)13)20-16(21)19-10-4-6-11(7-5-10)25(18,22)23/h1-7,14H,8-9H2,(H2,18,22,23)(H2,19,20,21)/t14-/m0/s1 |
| InChIKey | IZPOKGXCFDJBDM-AWEZNQCLSA-N |
| XLogP | 2.83 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |