C17H17FN2O3S2 — CID 55462599
N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-(methylsulfamoyl)benzamide (PubChem CID 55462599) has the molecular formula C17H17FN2O3S2 and a molecular weight of 380.47 g/mol. Its IUPAC name is N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-(methylsulfamoyl)benzamide.
| Compound Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55462599 |
| Molecular Formula | C17H17FN2O3S2 |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NC2CCSc3c(F)cccc32)cc1 |
| InChI | InChI=1S/C17H17FN2O3S2/c1-19-25(22,23)12-7-5-11(6-8-12)17(21)20-15-9-10-24-16-13(15)3-2-4-14(16)18/h2-8,15,19H,9-10H2,1H3,(H,20,21) |
| InChIKey | OQQFGCAHYFJHSV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |