C16H13FN2O3S — CID 25401649
N-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-nitrobenzamide (PubChem CID 25401649) has the molecular formula C16H13FN2O3S and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-nitrobenzamide.
| Compound Name | N-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 25401649 |
| Molecular Formula | C16H13FN2O3S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-nitrobenzamide |
| SMILES | O=C(N[C@H]1CCSc2c(F)cccc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13FN2O3S/c17-13-6-2-5-12-14(7-8-23-15(12)13)18-16(20)10-3-1-4-11(9-10)19(21)22/h1-6,9,14H,7-8H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | WIWYOLJCRYVABV-AWEZNQCLSA-N |
| XLogP | 3.70 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|