C18H14FN5O3S — CID 26008405
N-[(4R)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 26008405) has the molecular formula C18H14FN5O3S and a molecular weight of 399.41 g/mol. Its IUPAC name is N-[(4R)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(4R)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 26008405 |
| Molecular Formula | C18H14FN5O3S |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[(4R)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(N[C@@H]1CCSc2c(F)cccc21)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14FN5O3S/c19-13-3-1-2-12-14(6-7-28-17(12)13)22-18(25)11-4-5-15(16(8-11)24(26)27)23-10-20-9-21-23/h1-5,8-10,14H,6-7H2,(H,22,25)/t14-/m1/s1 |
| InChIKey | RXVZMZIZWWXEPL-CQSZACIVSA-N |
| XLogP | 3.28 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|