C19H17N5O3 — CID 166179782
3-nitro-N-(3-phenylcyclobutyl)-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 166179782) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is 3-nitro-N-(3-phenylcyclobutyl)-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | 3-nitro-N-(3-phenylcyclobutyl)-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 166179782 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-nitro-N-(3-phenylcyclobutyl)-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(NC1CC(c2ccccc2)C1)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N5O3/c25-19(22-16-8-15(9-16)13-4-2-1-3-5-13)14-6-7-17(18(10-14)24(26)27)23-12-20-11-21-23/h1-7,10-12,15-16H,8-9H2,(H,22,25) |
| InChIKey | CGWWLRHJVHUPNW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|