C16H10F3N5O4 — CID 35204205
3-nitro-4-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethoxy)phenyl]benzamide (PubChem CID 35204205) has the molecular formula C16H10F3N5O4 and a molecular weight of 393.28 g/mol. Its IUPAC name is 3-nitro-4-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 3-nitro-4-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 35204205 |
| Molecular Formula | C16H10F3N5O4 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-nitro-4-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10F3N5O4/c17-16(18,19)28-14-4-2-1-3-11(14)22-15(25)10-5-6-12(13(7-10)24(26)27)23-9-20-8-21-23/h1-9H,(H,22,25) |
| InChIKey | XIYGOMBPUYQBDK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|