C16H11F2N5O4 — CID 17414087
N-[2-(difluoromethoxy)phenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 17414087) has the molecular formula C16H11F2N5O4 and a molecular weight of 375.29 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 17414087 |
| Molecular Formula | C16H11F2N5O4 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(Nc1ccccc1OC(F)F)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11F2N5O4/c17-16(18)27-14-4-2-1-3-11(14)21-15(24)10-5-6-12(13(7-10)23(25)26)22-9-19-8-20-22/h1-9,16H,(H,21,24) |
| InChIKey | RWCFFORJIWRDJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|