C18H16N6O5 — CID 24979129
N'-[2-(2-methylphenoxy)acetyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide (PubChem CID 24979129) has the molecular formula C18H16N6O5 and a molecular weight of 396.36 g/mol. Its IUPAC name is N'-[2-(2-methylphenoxy)acetyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide.
| Compound Name | N'-[2-(2-methylphenoxy)acetyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 24979129 |
| Molecular Formula | C18H16N6O5 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N'-[2-(2-methylphenoxy)acetyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide |
| SMILES | Cc1ccccc1OCC(=O)NNC(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N6O5/c1-12-4-2-3-5-16(12)29-9-17(25)21-22-18(26)13-6-7-14(15(8-13)24(27)28)23-11-19-10-20-23/h2-8,10-11H,9H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | UCZYUEKTHYJUIO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|