C18H15FN6O5 — CID 26771959
N'-[(2R)-2-(2-fluorophenoxy)propanoyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide (PubChem CID 26771959) has the molecular formula C18H15FN6O5 and a molecular weight of 414.35 g/mol. Its IUPAC name is N'-[(2R)-2-(2-fluorophenoxy)propanoyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide.
| Compound Name | N'-[(2R)-2-(2-fluorophenoxy)propanoyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 26771959 |
| Molecular Formula | C18H15FN6O5 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N'-[(2R)-2-(2-fluorophenoxy)propanoyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide |
| SMILES | C[C@@H](Oc1ccccc1F)C(=O)NNC(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15FN6O5/c1-11(30-16-5-3-2-4-13(16)19)17(26)22-23-18(27)12-6-7-14(15(8-12)25(28)29)24-10-20-9-21-24/h2-11H,1H3,(H,22,26)(H,23,27)/t11-/m1/s1 |
| InChIKey | VYSZUFBHYIQLNB-LLVKDONJSA-N |
| XLogP | 1.54 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|