C20H17FN4O5S2 — CID 27815245
N'-[(2S)-2-(2-fluorophenoxy)propanoyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzohydrazide (PubChem CID 27815245) has the molecular formula C20H17FN4O5S2 and a molecular weight of 476.51 g/mol. Its IUPAC name is N'-[(2S)-2-(2-fluorophenoxy)propanoyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[(2S)-2-(2-fluorophenoxy)propanoyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 27815245 |
| Molecular Formula | C20H17FN4O5S2 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N'-[(2S)-2-(2-fluorophenoxy)propanoyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzohydrazide |
| SMILES | Cc1csc(Sc2ccc(C(=O)NNC(=O)[C@H](C)Oc3ccccc3F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H17FN4O5S2/c1-11-10-31-20(22-11)32-17-8-7-13(9-15(17)25(28)29)19(27)24-23-18(26)12(2)30-16-6-4-3-5-14(16)21/h3-10,12H,1-2H3,(H,23,26)(H,24,27)/t12-/m0/s1 |
| InChIKey | RBBMPIVIJQDOAD-LBPRGKRZSA-N |
| XLogP | 3.88 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|