C21H17N5O4S2 — CID 26932750
N'-[2-(1H-indol-3-yl)acetyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzohydrazide (PubChem CID 26932750) has the molecular formula C21H17N5O4S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 26932750 |
| Molecular Formula | C21H17N5O4S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzohydrazide |
| SMILES | Cc1csc(Sc2ccc(C(=O)NNC(=O)Cc3c[nH]c4ccccc34)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C21H17N5O4S2/c1-12-11-31-21(23-12)32-18-7-6-13(8-17(18)26(29)30)20(28)25-24-19(27)9-14-10-22-16-5-3-2-4-15(14)16/h2-8,10-11,22H,9H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | RBMIMBBYNIGWOE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|