C15H18N4O3S2 — CID 119627793
N-(2-amino-2-methylpropyl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 119627793) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-(2-amino-2-methylpropyl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 119627793 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cc1csc(Sc2ccc(C(=O)NCC(C)(C)N)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H18N4O3S2/c1-9-7-23-14(18-9)24-12-5-4-10(6-11(12)19(21)22)13(20)17-8-15(2,3)16/h4-7H,8,16H2,1-3H3,(H,17,20) |
| InChIKey | IUZUIOFXCMFCPW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|