C12H18ClN3O3S — CID 119629054
N-(2-amino-2-methylpropyl)-4-methylsulfanyl-3-nitrobenzamide;hydrochloride (PubChem CID 119629054) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-4-methylsulfanyl-3-nitrobenzamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-4-methylsulfanyl-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119629054 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-4-methylsulfanyl-3-nitrobenzamide;hydrochloride |
| SMILES | CSc1ccc(C(=O)NCC(C)(C)N)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H17N3O3S.ClH/c1-12(2,13)7-14-11(16)8-4-5-10(19-3)9(6-8)15(17)18;/h4-6H,7,13H2,1-3H3,(H,14,16);1H |
| InChIKey | LCIWHPFGAPFFDS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|