C12H14N2O6S — CID 103957999
methyl 2-hydroxy-3-[(4-methylsulfanyl-3-nitrobenzoyl)amino]propanoate (PubChem CID 103957999) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(4-methylsulfanyl-3-nitrobenzoyl)amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(4-methylsulfanyl-3-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 103957999 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | methyl 2-hydroxy-3-[(4-methylsulfanyl-3-nitrobenzoyl)amino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1ccc(SC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O6S/c1-20-12(17)9(15)6-13-11(16)7-3-4-10(21-2)8(5-7)14(18)19/h3-5,9,15H,6H2,1-2H3,(H,13,16) |
| InChIKey | OHRGUWDEDJGNRM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|