C19H14N4O3S3 — CID 38283926
N-(1,3-benzothiazol-2-ylmethyl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 38283926) has the molecular formula C19H14N4O3S3 and a molecular weight of 442.55 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 38283926 |
| Molecular Formula | C19H14N4O3S3 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cc1csc(Sc2ccc(C(=O)NCc3nc4ccccc4s3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H14N4O3S3/c1-11-10-27-19(21-11)29-16-7-6-12(8-14(16)23(25)26)18(24)20-9-17-22-13-4-2-3-5-15(13)28-17/h2-8,10H,9H2,1H3,(H,20,24) |
| InChIKey | UIZYWUYILXDYKR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|