C23H18N4O5S2 — CID 55613804
N-[3-[[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 55613804) has the molecular formula C23H18N4O5S2 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[3-[[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55613804 |
| Molecular Formula | C23H18N4O5S2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-[3-[[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1csc(Sc2ccc(C(=O)NCc3cccc(NC(=O)c4ccco4)c3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C23H18N4O5S2/c1-14-13-33-23(25-14)34-20-8-7-16(11-18(20)27(30)31)21(28)24-12-15-4-2-5-17(10-15)26-22(29)19-6-3-9-32-19/h2-11,13H,12H2,1H3,(H,24,28)(H,26,29) |
| InChIKey | QZVPRLAEZPZJLK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|