C19H15N3O6S2 — CID 56543003
methyl 2-hydroxy-3-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]benzoate (PubChem CID 56543003) has the molecular formula C19H15N3O6S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 56543003 |
| Molecular Formula | C19H15N3O6S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | methyl 2-hydroxy-3-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(Sc3nc(C)cs3)c([N+](=O)[O-])c2)c1O |
| InChI | InChI=1S/C19H15N3O6S2/c1-10-9-29-19(20-10)30-15-7-6-11(8-14(15)22(26)27)17(24)21-13-5-3-4-12(16(13)23)18(25)28-2/h3-9,23H,1-2H3,(H,21,24) |
| InChIKey | IJZWOUNDBLONAN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|