C19H13N5O5S3 — CID 42979599
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 42979599) has the molecular formula C19H13N5O5S3 and a molecular weight of 487.54 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 42979599 |
| Molecular Formula | C19H13N5O5S3 |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OCC(=O)Nc3cccc4nsnc34)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H13N5O5S3/c1-10-9-30-19(20-10)31-15-6-5-11(7-14(15)24(27)28)18(26)29-8-16(25)21-12-3-2-4-13-17(12)23-32-22-13/h2-7,9H,8H2,1H3,(H,21,25) |
| InChIKey | HEZZGGUVPKTMQF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|