C22H22N2O4S2 — CID 2426463
(4-tert-butylphenyl)methyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2426463) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | (4-tert-butylphenyl)methyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2426463 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (4-tert-butylphenyl)methyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OCc3ccc(C(C)(C)C)cc3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C22H22N2O4S2/c1-14-13-29-21(23-14)30-19-10-7-16(11-18(19)24(26)27)20(25)28-12-15-5-8-17(9-6-15)22(2,3)4/h5-11,13H,12H2,1-4H3 |
| InChIKey | OHCUGCDXVSHTBA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|