C19H16N4O4S2 — CID 55614464
N-[4-(2-amino-2-oxoethyl)phenyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 55614464) has the molecular formula C19H16N4O4S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55614464 |
| Molecular Formula | C19H16N4O4S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cc1csc(Sc2ccc(C(=O)Nc3ccc(CC(N)=O)cc3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H16N4O4S2/c1-11-10-28-19(21-11)29-16-7-4-13(9-15(16)23(26)27)18(25)22-14-5-2-12(3-6-14)8-17(20)24/h2-7,9-10H,8H2,1H3,(H2,20,24)(H,22,25) |
| InChIKey | NFNPWMOCKOZHMP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|