C17H21N3O4S2 — CID 97332704
N-[(2R,3R)-1-hydroxy-3-methylpentan-2-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 97332704) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[(2R,3R)-1-hydroxy-3-methylpentan-2-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-[(2R,3R)-1-hydroxy-3-methylpentan-2-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 97332704 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-[(2R,3R)-1-hydroxy-3-methylpentan-2-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | CCC(C)[C@H](CO)NC(=O)c1ccc(Sc2nc(C)cs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-4-10(2)13(8-21)19-16(22)12-5-6-15(14(7-12)20(23)24)26-17-18-11(3)9-25-17/h5-7,9-10,13,21H,4,8H2,1-3H3,(H,19,22)/t10?,13-/m0/s1 |
| InChIKey | LIWRRZBPFMJMFQ-HQVZTVAUSA-N |
| XLogP | 3.65 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|