C17H14N4O5S3 — CID 55383656
methyl 4-methyl-2-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 55383656) has the molecular formula C17H14N4O5S3 and a molecular weight of 450.52 g/mol. Its IUPAC name is methyl 4-methyl-2-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-methyl-2-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55383656 |
| Molecular Formula | C17H14N4O5S3 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | methyl 4-methyl-2-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)c2ccc(Sc3nc(C)cs3)c([N+](=O)[O-])c2)nc1C |
| InChI | InChI=1S/C17H14N4O5S3/c1-8-7-27-17(18-8)28-12-5-4-10(6-11(12)21(24)25)14(22)20-16-19-9(2)13(29-16)15(23)26-3/h4-7H,1-3H3,(H,19,20,22) |
| InChIKey | ARCVDRNMMVBOGX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|