C20H16N4O5S2 — CID 46628608
N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 46628608) has the molecular formula C20H16N4O5S2 and a molecular weight of 456.51 g/mol. Its IUPAC name is N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 46628608 |
| Molecular Formula | C20H16N4O5S2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cc1csc(Sc2ccc(C(=O)Nc3ccc4c(c3)NC(=O)C(C)O4)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H16N4O5S2/c1-10-9-30-20(21-10)31-17-6-3-12(7-15(17)24(27)28)19(26)22-13-4-5-16-14(8-13)23-18(25)11(2)29-16/h3-9,11H,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | WUANKPYWRMSRRK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|