C19H13F2N3O5S2 — CID 35971907
[2-(2,5-difluoroanilino)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 35971907) has the molecular formula C19H13F2N3O5S2 and a molecular weight of 465.46 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 35971907 |
| Molecular Formula | C19H13F2N3O5S2 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OCC(=O)Nc3cc(F)ccc3F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H13F2N3O5S2/c1-10-9-30-19(22-10)31-16-5-2-11(6-15(16)24(27)28)18(26)29-8-17(25)23-14-7-12(20)3-4-13(14)21/h2-7,9H,8H2,1H3,(H,23,25) |
| InChIKey | GMMIXDRFHGNAOW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|