C19H13BrN4O7S2 — CID 4023864
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (PubChem CID 4023864) has the molecular formula C19H13BrN4O7S2 and a molecular weight of 553.37 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 4023864 |
| Molecular Formula | C19H13BrN4O7S2 |
| Molecular Weight | 553.37 g/mol |
| Exact Mass | 551.94 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc([N+](=O)[O-])cc2C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)n1 |
| InChI | InChI=1S/C19H13BrN4O7S2/c1-10-9-32-19(21-10)33-16-5-3-11(23(27)28)6-13(16)18(26)31-8-17(25)22-15-4-2-12(24(29)30)7-14(15)20/h2-7,9H,8H2,1H3,(H,22,25) |
| InChIKey | RQAVYQSHAGCZKZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 154.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|