C19H15N3O5S2 — CID 55641862
(3-carbamoylphenyl)methyl 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (PubChem CID 55641862) has the molecular formula C19H15N3O5S2 and a molecular weight of 429.48 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
| Compound Name | (3-carbamoylphenyl)methyl 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 55641862 |
| Molecular Formula | C19H15N3O5S2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | (3-carbamoylphenyl)methyl 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc([N+](=O)[O-])cc2C(=O)OCc2cccc(C(N)=O)c2)n1 |
| InChI | InChI=1S/C19H15N3O5S2/c1-11-10-28-19(21-11)29-16-6-5-14(22(25)26)8-15(16)18(24)27-9-12-3-2-4-13(7-12)17(20)23/h2-8,10H,9H2,1H3,(H2,20,23) |
| InChIKey | FQSFWVRFVACODN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|