C20H17N3O5S3 — CID 42307025
[2-(4-methylsulfanylanilino)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (PubChem CID 42307025) has the molecular formula C20H17N3O5S3 and a molecular weight of 475.57 g/mol. Its IUPAC name is [2-(4-methylsulfanylanilino)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
| Compound Name | [2-(4-methylsulfanylanilino)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 42307025 |
| Molecular Formula | C20H17N3O5S3 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | [2-(4-methylsulfanylanilino)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| SMILES | CSc1ccc(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2Sc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C20H17N3O5S3/c1-12-11-30-20(21-12)31-17-8-5-14(23(26)27)9-16(17)19(25)28-10-18(24)22-13-3-6-15(29-2)7-4-13/h3-9,11H,10H2,1-2H3,(H,22,24) |
| InChIKey | PHVPIWMFAIAJCM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|