C18H15N3O5S3 — CID 2636732
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (PubChem CID 2636732) has the molecular formula C18H15N3O5S3 and a molecular weight of 449.54 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 2636732 |
| Molecular Formula | C18H15N3O5S3 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc([N+](=O)[O-])cc2C(=O)OCC(=O)NCc2cccs2)n1 |
| InChI | InChI=1S/C18H15N3O5S3/c1-11-10-28-18(20-11)29-15-5-4-12(21(24)25)7-14(15)17(23)26-9-16(22)19-8-13-3-2-6-27-13/h2-7,10H,8-9H2,1H3,(H,19,22) |
| InChIKey | HMFVJOIWVNLTKF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|