C17H14N4O6S2 — CID 16961974
[2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (PubChem CID 16961974) has the molecular formula C17H14N4O6S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
| Compound Name | [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 16961974 |
| Molecular Formula | C17H14N4O6S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2Sc2nc(C)cs2)on1 |
| InChI | InChI=1S/C17H14N4O6S2/c1-9-5-15(27-20-9)19-14(22)7-26-16(23)12-6-11(21(24)25)3-4-13(12)29-17-18-10(2)8-28-17/h3-6,8H,7H2,1-2H3,(H,19,22) |
| InChIKey | NABUVIAZPONAKZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|