C24H23N3O6S2 — CID 2475579
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (PubChem CID 2475579) has the molecular formula C24H23N3O6S2 and a molecular weight of 513.60 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 2475579 |
| Molecular Formula | C24H23N3O6S2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc([N+](=O)[O-])cc2C(=O)OCC(=O)c2ccc(NC(=O)CC(C)C)cc2)n1 |
| InChI | InChI=1S/C24H23N3O6S2/c1-14(2)10-22(29)26-17-6-4-16(5-7-17)20(28)12-33-23(30)19-11-18(27(31)32)8-9-21(19)35-24-25-15(3)13-34-24/h4-9,11,13-14H,10,12H2,1-3H3,(H,26,29) |
| InChIKey | NQDXSOGKDGECOI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|