C20H14F3N3O5S2 — CID 2637550
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (PubChem CID 2637550) has the molecular formula C20H14F3N3O5S2 and a molecular weight of 497.48 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 2637550 |
| Molecular Formula | C20H14F3N3O5S2 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc([N+](=O)[O-])cc2C(=O)OCC(=O)Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C20H14F3N3O5S2/c1-11-10-32-19(24-11)33-16-7-6-12(26(29)30)8-13(16)18(28)31-9-17(27)25-15-5-3-2-4-14(15)20(21,22)23/h2-8,10H,9H2,1H3,(H,25,27) |
| InChIKey | MNGPTAXCUFXTBJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|