C21H23N3O7S2 — CID 35990037
ethyl 1-[2-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 35990037) has the molecular formula C21H23N3O7S2 and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl 1-[2-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 35990037 |
| Molecular Formula | C21H23N3O7S2 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | ethyl 1-[2-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)c2cc([N+](=O)[O-])ccc2Sc2nc(C)cs2)CC1 |
| InChI | InChI=1S/C21H23N3O7S2/c1-3-30-19(26)14-6-8-23(9-7-14)18(25)11-31-20(27)16-10-15(24(28)29)4-5-17(16)33-21-22-13(2)12-32-21/h4-5,10,12,14H,3,6-9,11H2,1-2H3 |
| InChIKey | ZCQFWDRPTBVUNM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 128.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|