C17H20N2O7 — CID 9454739
ethyl 1-[2-(2-nitrobenzoyl)oxyacetyl]piperidine-4-carboxylate (PubChem CID 9454739) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is ethyl 1-[2-(2-nitrobenzoyl)oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(2-nitrobenzoyl)oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9454739 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl 1-[2-(2-nitrobenzoyl)oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H20N2O7/c1-2-25-16(21)12-7-9-18(10-8-12)15(20)11-26-17(22)13-5-3-4-6-14(13)19(23)24/h3-6,12H,2,7-11H2,1H3 |
| InChIKey | MAGNIDHQDKRYBR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|