C20H27N3O5 — CID 46794254
[2-(azepan-1-yl)-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 46794254) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46794254 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCCC1)C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H27N3O5/c24-19(22-11-5-1-2-6-12-22)15-28-20(25)16-9-13-21(14-10-16)17-7-3-4-8-18(17)23(26)27/h3-4,7-8,16H,1-2,5-6,9-15H2 |
| InChIKey | YBVPVWBVFYFXFO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|