C19H19ClN2O4 — CID 7835650
(3-chlorophenyl)methyl 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 7835650) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | (3-chlorophenyl)methyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7835650 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (3-chlorophenyl)methyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | O=C(OCc1cccc(Cl)c1)C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H19ClN2O4/c20-16-5-3-4-14(12-16)13-26-19(23)15-8-10-21(11-9-15)17-6-1-2-7-18(17)22(24)25/h1-7,12,15H,8-11,13H2 |
| InChIKey | UBMRRHSEGPQSOC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|