C24H24N2O6 — CID 46794261
(7-ethyl-2-oxochromen-4-yl)methyl 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 46794261) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46794261 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | CCc1ccc2c(COC(=O)C3CCN(c4ccccc4[N+](=O)[O-])CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H24N2O6/c1-2-16-7-8-19-18(14-23(27)32-22(19)13-16)15-31-24(28)17-9-11-25(12-10-17)20-5-3-4-6-21(20)26(29)30/h3-8,13-14,17H,2,9-12,15H2,1H3 |
| InChIKey | XELZSVJHZFMQHB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|