C24H23NO5 — CID 8524471
(7-ethyl-2-oxochromen-4-yl)methyl (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 8524471) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 8524471 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccc2c(COC(=O)[C@@H]3CC(=O)N(c4ccc(C)cc4)C3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H23NO5/c1-3-16-6-9-20-18(12-23(27)30-21(20)10-16)14-29-24(28)17-11-22(26)25(13-17)19-7-4-15(2)5-8-19/h4-10,12,17H,3,11,13-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | SIAGTYIIAHPNCW-QGZVFWFLSA-N |
| XLogP | 3.76 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|