C26H27NO5 — CID 25445738
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 25445738) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 25445738 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(N2C[C@H](C(=O)OCc3cc(=O)oc4cc(C)c(C(C)C)cc34)CC2=O)cc1 |
| InChI | InChI=1S/C26H27NO5/c1-15(2)21-12-22-19(11-25(29)32-23(22)9-17(21)4)14-31-26(30)18-10-24(28)27(13-18)20-7-5-16(3)6-8-20/h5-9,11-12,15,18H,10,13-14H2,1-4H3/t18-/m1/s1 |
| InChIKey | CCALJBFTPNIMOV-GOSISDBHSA-N |
| XLogP | 4.63 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|