C24H27NO6S — CID 42969357
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 42969357) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 42969357 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)OCc2cc(=O)oc3cc(C)c(C(C)C)cc23)cc1 |
| InChI | InChI=1S/C24H27NO6S/c1-15(2)20-13-21-18(12-24(27)31-22(21)11-17(20)4)14-30-23(26)9-10-25-32(28,29)19-7-5-16(3)6-8-19/h5-8,11-13,15,25H,9-10,14H2,1-4H3 |
| InChIKey | AFPBUNXNAICXSV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|